C30H24Cl2N8S2 — CID 166346198
3-[4-(3,4-dichlorophenyl)-5-[(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,2,4-triazol-3-yl]-N,N-dimethylaniline (PubChem CID 166346198) has the molecular formula C30H24Cl2N8S2 and a molecular weight of 631.62 g/mol. Its IUPAC name is 3-[4-(3,4-dichlorophenyl)-5-[(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,2,4-triazol-3-yl]-N,N-dimethylaniline.
| Compound Name | 3-[4-(3,4-dichlorophenyl)-5-[(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,2,4-triazol-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 166346198 |
| Molecular Formula | C30H24Cl2N8S2 |
| Molecular Weight | 631.62 g/mol |
| Exact Mass | 630.09 |
| IUPAC Name | 3-[4-(3,4-dichlorophenyl)-5-[(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-1,2,4-triazol-3-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(-c2nnc(Sc3nc(-c4cnccn4)nc4sc5c(c34)CCCC5)n2-c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C30H24Cl2N8S2/c1-39(2)18-7-5-6-17(14-18)27-37-38-30(40(27)19-10-11-21(31)22(32)15-19)42-29-25-20-8-3-4-9-24(20)41-28(25)35-26(36-29)23-16-33-12-13-34-23/h5-7,10-16H,3-4,8-9H2,1-2H3 |
| InChIKey | ZHHOGHSZFMLGOK-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 85.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.62 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |