C20H23N5OS — CID 100665251
(2S,5R)-2,5-dimethyl-4-(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)morpholine (PubChem CID 100665251) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethyl-4-(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)morpholine.
| Compound Name | (2S,5R)-2,5-dimethyl-4-(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 100665251 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (2S,5R)-2,5-dimethyl-4-(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)morpholine |
| SMILES | C[C@@H]1CO[C@@H](C)CN1c1nc(-c2cnccn2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C20H23N5OS/c1-12-11-26-13(2)10-25(12)19-17-14-5-3-4-6-16(14)27-20(17)24-18(23-19)15-9-21-7-8-22-15/h7-9,12-13H,3-6,10-11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | SZUQTKVTHPKOIQ-OLZOCXBDSA-N |
| XLogP | 3.64 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |