C19H19N7OS — CID 75401539
N-methyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 75401539) has the molecular formula C19H19N7OS and a molecular weight of 393.48 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 75401539 |
| Molecular Formula | C19H19N7OS |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-methyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(CN(C)c2nc(-c3cnccn3)nc3sc4c(c23)CCCC4)no1 |
| InChI | InChI=1S/C19H19N7OS/c1-11-22-15(25-27-11)10-26(2)18-16-12-5-3-4-6-14(12)28-19(16)24-17(23-18)13-9-20-7-8-21-13/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | XKDAULXKPULGKS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 93.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |