C11H16N4OS2 — CID 133275856
2-(2-tert-butylsulfanylethylamino)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 133275856) has the molecular formula C11H16N4OS2 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-(2-tert-butylsulfanylethylamino)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-(2-tert-butylsulfanylethylamino)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 133275856 |
| Molecular Formula | C11H16N4OS2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(2-tert-butylsulfanylethylamino)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CC(C)(C)SCCNc1nn2c(=O)ccnc2s1 |
| InChI | InChI=1S/C11H16N4OS2/c1-11(2,3)17-7-6-12-9-14-15-8(16)4-5-13-10(15)18-9/h4-5H,6-7H2,1-3H3,(H,12,14) |
| InChIKey | MYBWXWQYVLOFKS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|