C17H20N4O2S — CID 133293611
2-[2-(2-tert-butylphenoxy)ethylamino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 133293611) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-[2-(2-tert-butylphenoxy)ethylamino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-[2-(2-tert-butylphenoxy)ethylamino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 133293611 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[2-(2-tert-butylphenoxy)ethylamino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CC(C)(C)c1ccccc1OCCNc1nn2c(=O)ccnc2s1 |
| InChI | InChI=1S/C17H20N4O2S/c1-17(2,3)12-6-4-5-7-13(12)23-11-10-18-15-20-21-14(22)8-9-19-16(21)24-15/h4-9H,10-11H2,1-3H3,(H,18,20) |
| InChIKey | TXDHRLQXJZUSTB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|