C10H16ClN3OS — CID 133275925
4-(2-tert-butylsulfanylethylamino)-5-chloro-1H-pyridazin-6-one (PubChem CID 133275925) has the molecular formula C10H16ClN3OS and a molecular weight of 261.78 g/mol. Its IUPAC name is 4-(2-tert-butylsulfanylethylamino)-5-chloro-1H-pyridazin-6-one.
| Compound Name | 4-(2-tert-butylsulfanylethylamino)-5-chloro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 133275925 |
| Molecular Formula | C10H16ClN3OS |
| Molecular Weight | 261.78 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 4-(2-tert-butylsulfanylethylamino)-5-chloro-1H-pyridazin-6-one |
| SMILES | CC(C)(C)SCCNc1cn[nH]c(=O)c1Cl |
| InChI | InChI=1S/C10H16ClN3OS/c1-10(2,3)16-5-4-12-7-6-13-14-9(15)8(7)11/h6H,4-5H2,1-3H3,(H2,12,14,15) |
| InChIKey | YEYCJIWJEBBACX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.78 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|