C18H20N2O — CID 133277066
2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]pyridine (PubChem CID 133277066) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]pyridine.
| Compound Name | 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]pyridine |
|---|---|
| PubChem CID | 133277066 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]pyridine |
| SMILES | CCOc1ccccc1C1=CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H20N2O/c1-2-21-17-8-4-3-7-16(17)15-10-13-20(14-11-15)18-9-5-6-12-19-18/h3-10,12H,2,11,13-14H2,1H3 |
| InChIKey | GKNVLALBLNVZKA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |