About 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine
2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine (PubChem CID 133277071) has the molecular formula C22H27N3O3S
and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine.
Molecular Properties
| Compound Name | 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine |
| PubChem CID | 133277071 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine |
| SMILES | CCOc1ccccc1C1=CCN(c2ccc(S(=O)(=O)N3CCCC3)cn2)CC1 |
| InChI | InChI=1S/C22H27N3O3S/c1-2-28-21-8-4-3-7-20(21)18-11-15-24(16-12-18)22-10-9-19(17-23-22)29(26,27)25-13-5-6-14-25/h3-4,7-11,17H,2,5-6,12-16H2,1H3 |
| InChIKey | VLZNJKAFHXRLQO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine?
The IUPAC name of 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine (CID 133277071) is 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine.
What is the SMILES notation for 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine?
The canonical SMILES for 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine is CCOc1ccccc1C1=CCN(c2ccc(S(=O)(=O)N3CCCC3)cn2)CC1.
What is the InChIKey of 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine?
The InChIKey is VLZNJKAFHXRLQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O3S/c1-2-28-21-8-4-3-7-20(21)18-11-15-24(16-12-18)22-10-9-19(17-23-22)29(26,27)25-13-5-6-14-25/h3-4,7-11,17H,2,5-6,12-16H2,1H3.
What are the key properties of 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine?
2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine has a molecular weight of 413.54 g/mol, XLogP of 3.56, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-ethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-pyrrolidin-1-ylsulfonylpyridine is sourced from PubChem (CID 133277071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).