C23H18FN5O — CID 133277145
4-[[[6-(4-fluorophenyl)pyridazin-3-yl]amino]methyl]-N-pyridin-4-ylbenzamide (PubChem CID 133277145) has the molecular formula C23H18FN5O and a molecular weight of 399.43 g/mol. Its IUPAC name is 4-[[[6-(4-fluorophenyl)pyridazin-3-yl]amino]methyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[[[6-(4-fluorophenyl)pyridazin-3-yl]amino]methyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 133277145 |
| Molecular Formula | C23H18FN5O |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-[[[6-(4-fluorophenyl)pyridazin-3-yl]amino]methyl]-N-pyridin-4-ylbenzamide |
| SMILES | O=C(Nc1ccncc1)c1ccc(CNc2ccc(-c3ccc(F)cc3)nn2)cc1 |
| InChI | InChI=1S/C23H18FN5O/c24-19-7-5-17(6-8-19)21-9-10-22(29-28-21)26-15-16-1-3-18(4-2-16)23(30)27-20-11-13-25-14-12-20/h1-14H,15H2,(H,26,29)(H,25,27,30) |
| InChIKey | MOZHIKGLESNGDZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |