C17H17F3N4 — CID 133277335
N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 133277335) has the molecular formula C17H17F3N4 and a molecular weight of 334.35 g/mol. Its IUPAC name is N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133277335 |
| Molecular Formula | C17H17F3N4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCn1c(C(C)Nc2ccc(C(F)(F)F)cn2)nc2ccccc21 |
| InChI | InChI=1S/C17H17F3N4/c1-3-24-14-7-5-4-6-13(14)23-16(24)11(2)22-15-9-8-12(10-21-15)17(18,19)20/h4-11H,3H2,1-2H3,(H,21,22) |
| InChIKey | WSHULPDTVGHRCW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |