C24H22F3N3S — CID 143667958
(1R)-1-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]-N-(4-phenylphenyl)sulfanylethanamine (PubChem CID 143667958) has the molecular formula C24H22F3N3S and a molecular weight of 441.52 g/mol. Its IUPAC name is (1R)-1-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]-N-(4-phenylphenyl)sulfanylethanamine.
| Compound Name | (1R)-1-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]-N-(4-phenylphenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 143667958 |
| Molecular Formula | C24H22F3N3S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (1R)-1-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]-N-(4-phenylphenyl)sulfanylethanamine |
| SMILES | CCn1c([C@@H](C)NSc2ccc(-c3ccccc3)cc2)nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C24H22F3N3S/c1-3-30-22-15-19(24(25,26)27)11-14-21(22)28-23(30)16(2)29-31-20-12-9-18(10-13-20)17-7-5-4-6-8-17/h4-16,29H,3H2,1-2H3/t16-/m1/s1 |
| InChIKey | UYHSIXBUEUSEFM-MRXNPFEDSA-N |
| XLogP | 7.10 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|