C17H20N2O2 — CID 133277761
ethyl 4-[cyclopropylmethyl(methyl)amino]quinoline-3-carboxylate (PubChem CID 133277761) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is ethyl 4-[cyclopropylmethyl(methyl)amino]quinoline-3-carboxylate.
| Compound Name | ethyl 4-[cyclopropylmethyl(methyl)amino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 133277761 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | ethyl 4-[cyclopropylmethyl(methyl)amino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccccc2c1N(C)CC1CC1 |
| InChI | InChI=1S/C17H20N2O2/c1-3-21-17(20)14-10-18-15-7-5-4-6-13(15)16(14)19(2)11-12-8-9-12/h4-7,10,12H,3,8-9,11H2,1-2H3 |
| InChIKey | JSKNBTPIZKGMFM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |