C20H23N5OS — CID 133279182
4-(1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine (PubChem CID 133279182) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is 4-(1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine.
| Compound Name | 4-(1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 133279182 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-(1,2,3,3a,4,6,7,7a-octahydropyrazolo[4,3-c]pyridin-5-yl)-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine |
| SMILES | COCc1nc(N2CCC3NNCC3C2)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C20H23N5OS/c1-26-11-17-22-19(25-8-7-16-14(10-25)9-21-24-16)18-15(12-27-20(18)23-17)13-5-3-2-4-6-13/h2-6,12,14,16,21,24H,7-11H2,1H3 |
| InChIKey | UFCAYDRIOMXRGL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |