C17H17N7O3 — CID 133281286
1-[3-nitro-4-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]phenyl]ethanone (PubChem CID 133281286) has the molecular formula C17H17N7O3 and a molecular weight of 367.37 g/mol. Its IUPAC name is 1-[3-nitro-4-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-nitro-4-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 133281286 |
| Molecular Formula | C17H17N7O3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-[3-nitro-4-[4-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(c3ccc4nncn4n3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N7O3/c1-12(25)13-2-3-14(15(10-13)24(26)27)21-6-8-22(9-7-21)17-5-4-16-19-18-11-23(16)20-17/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | ZQKULDQEGSUGCT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|