C14H15N5O — CID 133284272
3-[(2-propoxy-3-pyridinyl)methylamino]pyrazine-2-carbonitrile (PubChem CID 133284272) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 3-[(2-propoxy-3-pyridinyl)methylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[(2-propoxy-3-pyridinyl)methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133284272 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 3-[(2-propoxy-3-pyridinyl)methylamino]pyrazine-2-carbonitrile |
| SMILES | CCCOc1ncccc1CNc1nccnc1C#N |
| InChI | InChI=1S/C14H15N5O/c1-2-8-20-14-11(4-3-5-18-14)10-19-13-12(9-15)16-6-7-17-13/h3-7H,2,8,10H2,1H3,(H,17,19) |
| InChIKey | FSLQLKZLAJJGGB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |