C17H15ClFN3O — CID 133286036
N-[2-(4-chloro-2-cyanoanilino)ethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 133286036) has the molecular formula C17H15ClFN3O and a molecular weight of 331.78 g/mol. Its IUPAC name is N-[2-(4-chloro-2-cyanoanilino)ethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-(4-chloro-2-cyanoanilino)ethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 133286036 |
| Molecular Formula | C17H15ClFN3O |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-[2-(4-chloro-2-cyanoanilino)ethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | N#Cc1cc(Cl)ccc1NCCNC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H15ClFN3O/c18-14-4-5-16(13(10-14)11-20)21-6-7-22-17(23)9-12-2-1-3-15(19)8-12/h1-5,8,10,21H,6-7,9H2,(H,22,23) |
| InChIKey | OCZKSZIPDKCGTJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|