C14H14ClFN4O2 — CID 47089936
N-[2-[(5-chloro-6-oxo-1H-pyridazin-4-yl)amino]ethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 47089936) has the molecular formula C14H14ClFN4O2 and a molecular weight of 324.74 g/mol. Its IUPAC name is N-[2-[(5-chloro-6-oxo-1H-pyridazin-4-yl)amino]ethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-[(5-chloro-6-oxo-1H-pyridazin-4-yl)amino]ethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 47089936 |
| Molecular Formula | C14H14ClFN4O2 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-[2-[(5-chloro-6-oxo-1H-pyridazin-4-yl)amino]ethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | O=C(Cc1cccc(F)c1)NCCNc1cn[nH]c(=O)c1Cl |
| InChI | InChI=1S/C14H14ClFN4O2/c15-13-11(8-19-20-14(13)22)17-4-5-18-12(21)7-9-2-1-3-10(16)6-9/h1-3,6,8H,4-5,7H2,(H,18,21)(H2,17,20,22) |
| InChIKey | GZYXRUSFGBWSHL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|