C17H16N4O2S — CID 133287442
4-(2-pyridin-3-ylquinazolin-4-yl)-1,4-thiazinane 1,1-dioxide (PubChem CID 133287442) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 4-(2-pyridin-3-ylquinazolin-4-yl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(2-pyridin-3-ylquinazolin-4-yl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 133287442 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-(2-pyridin-3-ylquinazolin-4-yl)-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(c2nc(-c3cccnc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C17H16N4O2S/c22-24(23)10-8-21(9-11-24)17-14-5-1-2-6-15(14)19-16(20-17)13-4-3-7-18-12-13/h1-7,12H,8-11H2 |
| InChIKey | VRVKKRUTPOWOHF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |