C19H17F3N4 — CID 2540547
2-pyridin-3-yl-4-[(3S)-3-(trifluoromethyl)piperidin-1-yl]quinazoline (PubChem CID 2540547) has the molecular formula C19H17F3N4 and a molecular weight of 358.37 g/mol. Its IUPAC name is 2-pyridin-3-yl-4-[(3S)-3-(trifluoromethyl)piperidin-1-yl]quinazoline.
| Compound Name | 2-pyridin-3-yl-4-[(3S)-3-(trifluoromethyl)piperidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 2540547 |
| Molecular Formula | C19H17F3N4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-pyridin-3-yl-4-[(3S)-3-(trifluoromethyl)piperidin-1-yl]quinazoline |
| SMILES | FC(F)(F)[C@H]1CCCN(c2nc(-c3cccnc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C19H17F3N4/c20-19(21,22)14-6-4-10-26(12-14)18-15-7-1-2-8-16(15)24-17(25-18)13-5-3-9-23-11-13/h1-3,5,7-9,11,14H,4,6,10,12H2/t14-/m0/s1 |
| InChIKey | ORPOAZNTIGGKQZ-AWEZNQCLSA-N |
| XLogP | 4.47 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |