C24H23N5 — CID 133363141
N-phenyl-1-(2-pyridin-3-ylquinazolin-4-yl)piperidin-3-amine (PubChem CID 133363141) has the molecular formula C24H23N5 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-phenyl-1-(2-pyridin-3-ylquinazolin-4-yl)piperidin-3-amine.
| Compound Name | N-phenyl-1-(2-pyridin-3-ylquinazolin-4-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 133363141 |
| Molecular Formula | C24H23N5 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | N-phenyl-1-(2-pyridin-3-ylquinazolin-4-yl)piperidin-3-amine |
| SMILES | c1ccc(NC2CCCN(c3nc(-c4cccnc4)nc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C24H23N5/c1-2-9-19(10-3-1)26-20-11-7-15-29(17-20)24-21-12-4-5-13-22(21)27-23(28-24)18-8-6-14-25-16-18/h1-6,8-10,12-14,16,20,26H,7,11,15,17H2 |
| InChIKey | KORDMCGTZQNXNM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |