C20H28N6O — CID 133291151
cyclohexyl-[4-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]piperidin-1-yl]methanone (PubChem CID 133291151) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is cyclohexyl-[4-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]piperidin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 133291151 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | cyclohexyl-[4-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]piperidin-1-yl]methanone |
| SMILES | Cc1ccn(-c2ccc(NC3CCN(C(=O)C4CCCCC4)CC3)nn2)n1 |
| InChI | InChI=1S/C20H28N6O/c1-15-9-14-26(24-15)19-8-7-18(22-23-19)21-17-10-12-25(13-11-17)20(27)16-5-3-2-4-6-16/h7-9,14,16-17H,2-6,10-13H2,1H3,(H,21,22) |
| InChIKey | CNDKUTRFSACDMW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |