C14H13N7OS2 — CID 133293678
7-ethyl-2-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methylamino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 133293678) has the molecular formula C14H13N7OS2 and a molecular weight of 359.44 g/mol. Its IUPAC name is 7-ethyl-2-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methylamino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-ethyl-2-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methylamino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 133293678 |
| Molecular Formula | C14H13N7OS2 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 7-ethyl-2-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methylamino]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCc1cc(=O)n2nc(NCc3nc(-c4cccs4)n[nH]3)sc2n1 |
| InChI | InChI=1S/C14H13N7OS2/c1-2-8-6-11(22)21-14(16-8)24-13(20-21)15-7-10-17-12(19-18-10)9-4-3-5-23-9/h3-6H,2,7H2,1H3,(H,15,20)(H,17,18,19) |
| InChIKey | WXMOOHNGMISHDA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |