C21H19N5O3 — CID 133295953
1-[2-(3-nitro-2-pyridinyl)-3,4-dihydro-1H-isoquinolin-5-yl]-3-phenylurea (PubChem CID 133295953) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-[2-(3-nitro-2-pyridinyl)-3,4-dihydro-1H-isoquinolin-5-yl]-3-phenylurea.
| Compound Name | 1-[2-(3-nitro-2-pyridinyl)-3,4-dihydro-1H-isoquinolin-5-yl]-3-phenylurea |
|---|---|
| PubChem CID | 133295953 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-[2-(3-nitro-2-pyridinyl)-3,4-dihydro-1H-isoquinolin-5-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc2c1CCN(c1ncccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C21H19N5O3/c27-21(23-16-7-2-1-3-8-16)24-18-9-4-6-15-14-25(13-11-17(15)18)20-19(26(28)29)10-5-12-22-20/h1-10,12H,11,13-14H2,(H2,23,24,27) |
| InChIKey | DUFNKODMJYVJBQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|