C25H22N4O2 — CID 133457938
1-[2-(2-acetyl-5-cyanophenyl)-3,4-dihydro-1H-isoquinolin-5-yl]-3-phenylurea (PubChem CID 133457938) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 1-[2-(2-acetyl-5-cyanophenyl)-3,4-dihydro-1H-isoquinolin-5-yl]-3-phenylurea.
| Compound Name | 1-[2-(2-acetyl-5-cyanophenyl)-3,4-dihydro-1H-isoquinolin-5-yl]-3-phenylurea |
|---|---|
| PubChem CID | 133457938 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-[2-(2-acetyl-5-cyanophenyl)-3,4-dihydro-1H-isoquinolin-5-yl]-3-phenylurea |
| SMILES | CC(=O)c1ccc(C#N)cc1N1CCc2c(cccc2NC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C25H22N4O2/c1-17(30)21-11-10-18(15-26)14-24(21)29-13-12-22-19(16-29)6-5-9-23(22)28-25(31)27-20-7-3-2-4-8-20/h2-11,14H,12-13,16H2,1H3,(H2,27,28,31) |
| InChIKey | IPSMZUORFXIALZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |