C25H24N4O3 — CID 86903638
2-[5-[(4-methylphenyl)carbamoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-N-phenylacetamide (PubChem CID 86903638) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[5-[(4-methylphenyl)carbamoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-N-phenylacetamide.
| Compound Name | 2-[5-[(4-methylphenyl)carbamoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-N-phenylacetamide |
|---|---|
| PubChem CID | 86903638 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-[5-[(4-methylphenyl)carbamoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-N-phenylacetamide |
| SMILES | Cc1ccc(NC(=O)Nc2cccc3c2CCN(C(=O)C(=O)Nc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-17-10-12-20(13-11-17)27-25(32)28-22-9-5-6-18-16-29(15-14-21(18)22)24(31)23(30)26-19-7-3-2-4-8-19/h2-13H,14-16H2,1H3,(H,26,30)(H2,27,28,32) |
| InChIKey | DAYFYPRUPQEKRY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|