C22H29ClN4O2 — CID 119780223
1-[2-[4-(methylamino)butanoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(4-methylphenyl)urea;hydrochloride (PubChem CID 119780223) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 1-[2-[4-(methylamino)butanoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(4-methylphenyl)urea;hydrochloride.
| Compound Name | 1-[2-[4-(methylamino)butanoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(4-methylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 119780223 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-[2-[4-(methylamino)butanoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(4-methylphenyl)urea;hydrochloride |
| SMILES | CNCCCC(=O)N1CCc2c(cccc2NC(=O)Nc2ccc(C)cc2)C1.Cl |
| InChI | InChI=1S/C22H28N4O2.ClH/c1-16-8-10-18(11-9-16)24-22(28)25-20-6-3-5-17-15-26(14-12-19(17)20)21(27)7-4-13-23-2;/h3,5-6,8-11,23H,4,7,12-15H2,1-2H3,(H2,24,25,28);1H |
| InChIKey | WPUHOTNAFGLTAW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|