C24H23ClN4O2 — CID 86936082
1-[2-[2-(6-chloro-3-pyridinyl)acetyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(4-methylphenyl)urea (PubChem CID 86936082) has the molecular formula C24H23ClN4O2 and a molecular weight of 434.93 g/mol. Its IUPAC name is 1-[2-[2-(6-chloro-3-pyridinyl)acetyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[2-[2-(6-chloro-3-pyridinyl)acetyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 86936082 |
| Molecular Formula | C24H23ClN4O2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[2-[2-(6-chloro-3-pyridinyl)acetyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cccc3c2CCN(C(=O)Cc2ccc(Cl)nc2)C3)cc1 |
| InChI | InChI=1S/C24H23ClN4O2/c1-16-5-8-19(9-6-16)27-24(31)28-21-4-2-3-18-15-29(12-11-20(18)21)23(30)13-17-7-10-22(25)26-14-17/h2-10,14H,11-13,15H2,1H3,(H2,27,28,31) |
| InChIKey | XHDIONOMXANJOX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|