C24H21FN4O3 — CID 86936311
2-[5-[(2-fluorophenyl)carbamoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-N-phenylacetamide (PubChem CID 86936311) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-[5-[(2-fluorophenyl)carbamoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-N-phenylacetamide.
| Compound Name | 2-[5-[(2-fluorophenyl)carbamoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-N-phenylacetamide |
|---|---|
| PubChem CID | 86936311 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[5-[(2-fluorophenyl)carbamoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-N-phenylacetamide |
| SMILES | O=C(Nc1ccccc1F)Nc1cccc2c1CCN(C(=O)C(=O)Nc1ccccc1)C2 |
| InChI | InChI=1S/C24H21FN4O3/c25-19-10-4-5-11-21(19)28-24(32)27-20-12-6-7-16-15-29(14-13-18(16)20)23(31)22(30)26-17-8-2-1-3-9-17/h1-12H,13-15H2,(H,26,30)(H2,27,28,32) |
| InChIKey | NEVQULNVMHDOCN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|