C24H20F2N4O2 — CID 86936304
1-(2-fluorophenyl)-3-[2-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-3,4-dihydro-1H-isoquinolin-5-yl]urea (PubChem CID 86936304) has the molecular formula C24H20F2N4O2 and a molecular weight of 434.45 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[2-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-3,4-dihydro-1H-isoquinolin-5-yl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[2-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-3,4-dihydro-1H-isoquinolin-5-yl]urea |
|---|---|
| PubChem CID | 86936304 |
| Molecular Formula | C24H20F2N4O2 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[2-[(E)-3-(5-fluoro-3-pyridinyl)prop-2-enoyl]-3,4-dihydro-1H-isoquinolin-5-yl]urea |
| SMILES | O=C(Nc1ccccc1F)Nc1cccc2c1CCN(C(=O)/C=C/c1cncc(F)c1)C2 |
| InChI | InChI=1S/C24H20F2N4O2/c25-18-12-16(13-27-14-18)8-9-23(31)30-11-10-19-17(15-30)4-3-7-21(19)28-24(32)29-22-6-2-1-5-20(22)26/h1-9,12-14H,10-11,15H2,(H2,28,29,32)/b9-8+ |
| InChIKey | UHGAEIIUTQVCKN-CMDGGOBGSA-N |
| XLogP | 4.60 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|