C20H17F3N2O2S — CID 133297486
3-[1-[4-(difluoromethylsulfonyl)phenyl]-3,6-dihydro-2H-pyridin-4-yl]-6-fluoro-1H-indole (PubChem CID 133297486) has the molecular formula C20H17F3N2O2S and a molecular weight of 406.43 g/mol. Its IUPAC name is 3-[1-[4-(difluoromethylsulfonyl)phenyl]-3,6-dihydro-2H-pyridin-4-yl]-6-fluoro-1H-indole.
| Compound Name | 3-[1-[4-(difluoromethylsulfonyl)phenyl]-3,6-dihydro-2H-pyridin-4-yl]-6-fluoro-1H-indole |
|---|---|
| PubChem CID | 133297486 |
| Molecular Formula | C20H17F3N2O2S |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 3-[1-[4-(difluoromethylsulfonyl)phenyl]-3,6-dihydro-2H-pyridin-4-yl]-6-fluoro-1H-indole |
| SMILES | O=S(=O)(c1ccc(N2CC=C(c3c[nH]c4cc(F)ccc34)CC2)cc1)C(F)F |
| InChI | InChI=1S/C20H17F3N2O2S/c21-14-1-6-17-18(12-24-19(17)11-14)13-7-9-25(10-8-13)15-2-4-16(5-3-15)28(26,27)20(22)23/h1-7,11-12,20,24H,8-10H2 |
| InChIKey | HSTPWGJBUIWMHF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|