C18H15ClFN3 — CID 133359737
3-[1-(2-chloro-4-pyridinyl)-3,6-dihydro-2H-pyridin-4-yl]-6-fluoro-1H-indole (PubChem CID 133359737) has the molecular formula C18H15ClFN3 and a molecular weight of 327.79 g/mol. Its IUPAC name is 3-[1-(2-chloro-4-pyridinyl)-3,6-dihydro-2H-pyridin-4-yl]-6-fluoro-1H-indole.
| Compound Name | 3-[1-(2-chloro-4-pyridinyl)-3,6-dihydro-2H-pyridin-4-yl]-6-fluoro-1H-indole |
|---|---|
| PubChem CID | 133359737 |
| Molecular Formula | C18H15ClFN3 |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 3-[1-(2-chloro-4-pyridinyl)-3,6-dihydro-2H-pyridin-4-yl]-6-fluoro-1H-indole |
| SMILES | Fc1ccc2c(C3=CCN(c4ccnc(Cl)c4)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C18H15ClFN3/c19-18-10-14(3-6-21-18)23-7-4-12(5-8-23)16-11-22-17-9-13(20)1-2-15(16)17/h1-4,6,9-11,22H,5,7-8H2 |
| InChIKey | IVIZGFSDIDSGIM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|