C23H24ClFN4O2 — CID 133297848
N-[3-[[(4-chloro-8-fluoroquinolin-7-yl)amino]methyl]phenyl]-3-morpholin-4-ylpropanamide (PubChem CID 133297848) has the molecular formula C23H24ClFN4O2 and a molecular weight of 442.92 g/mol. Its IUPAC name is N-[3-[[(4-chloro-8-fluoroquinolin-7-yl)amino]methyl]phenyl]-3-morpholin-4-ylpropanamide.
| Compound Name | N-[3-[[(4-chloro-8-fluoroquinolin-7-yl)amino]methyl]phenyl]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 133297848 |
| Molecular Formula | C23H24ClFN4O2 |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[3-[[(4-chloro-8-fluoroquinolin-7-yl)amino]methyl]phenyl]-3-morpholin-4-ylpropanamide |
| SMILES | O=C(CCN1CCOCC1)Nc1cccc(CNc2ccc3c(Cl)ccnc3c2F)c1 |
| InChI | InChI=1S/C23H24ClFN4O2/c24-19-6-8-26-23-18(19)4-5-20(22(23)25)27-15-16-2-1-3-17(14-16)28-21(30)7-9-29-10-12-31-13-11-29/h1-6,8,14,27H,7,9-13,15H2,(H,28,30) |
| InChIKey | LUNNAJSLBGUZAP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |