C17H20ClN3O3 — CID 155168942
N-(4-chloro-8-methoxyquinolin-7-yl)-3-morpholin-4-ylpropanamide (PubChem CID 155168942) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is N-(4-chloro-8-methoxyquinolin-7-yl)-3-morpholin-4-ylpropanamide.
| Compound Name | N-(4-chloro-8-methoxyquinolin-7-yl)-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 155168942 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-(4-chloro-8-methoxyquinolin-7-yl)-3-morpholin-4-ylpropanamide |
| SMILES | COc1c(NC(=O)CCN2CCOCC2)ccc2c(Cl)ccnc12 |
| InChI | InChI=1S/C17H20ClN3O3/c1-23-17-14(3-2-12-13(18)4-6-19-16(12)17)20-15(22)5-7-21-8-10-24-11-9-21/h2-4,6H,5,7-11H2,1H3,(H,20,22) |
| InChIKey | KMQQKSLKJVUEDS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |