C17H20ClFN4O — CID 133298672
[1-[6-[1-(3-chloro-4-fluorophenyl)ethylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 133298672) has the molecular formula C17H20ClFN4O and a molecular weight of 350.83 g/mol. Its IUPAC name is [1-[6-[1-(3-chloro-4-fluorophenyl)ethylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[6-[1-(3-chloro-4-fluorophenyl)ethylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 133298672 |
| Molecular Formula | C17H20ClFN4O |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [1-[6-[1-(3-chloro-4-fluorophenyl)ethylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | CC(Nc1cc(N2CCCC2CO)ncn1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClFN4O/c1-11(12-4-5-15(19)14(18)7-12)22-16-8-17(21-10-20-16)23-6-2-3-13(23)9-24/h4-5,7-8,10-11,13,24H,2-3,6,9H2,1H3,(H,20,21,22) |
| InChIKey | SZFYZIAKSRVUSQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |