C19H25FN4O — CID 133350349
[1-[6-[1-(3-fluoro-4-methylphenyl)ethylamino]pyrimidin-4-yl]piperidin-3-yl]methanol (PubChem CID 133350349) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is [1-[6-[1-(3-fluoro-4-methylphenyl)ethylamino]pyrimidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[6-[1-(3-fluoro-4-methylphenyl)ethylamino]pyrimidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 133350349 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [1-[6-[1-(3-fluoro-4-methylphenyl)ethylamino]pyrimidin-4-yl]piperidin-3-yl]methanol |
| SMILES | Cc1ccc(C(C)Nc2cc(N3CCCC(CO)C3)ncn2)cc1F |
| InChI | InChI=1S/C19H25FN4O/c1-13-5-6-16(8-17(13)20)14(2)23-18-9-19(22-12-21-18)24-7-3-4-15(10-24)11-25/h5-6,8-9,12,14-15,25H,3-4,7,10-11H2,1-2H3,(H,21,22,23) |
| InChIKey | BCUCYSXNRJJLIH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |