C16H21BrN4O2 — CID 133375019
[1-[6-[2-(5-bromofuran-2-yl)ethylamino]pyrimidin-4-yl]piperidin-3-yl]methanol (PubChem CID 133375019) has the molecular formula C16H21BrN4O2 and a molecular weight of 381.27 g/mol. Its IUPAC name is [1-[6-[2-(5-bromofuran-2-yl)ethylamino]pyrimidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[6-[2-(5-bromofuran-2-yl)ethylamino]pyrimidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 133375019 |
| Molecular Formula | C16H21BrN4O2 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [1-[6-[2-(5-bromofuran-2-yl)ethylamino]pyrimidin-4-yl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(c2cc(NCCc3ccc(Br)o3)ncn2)C1 |
| InChI | InChI=1S/C16H21BrN4O2/c17-14-4-3-13(23-14)5-6-18-15-8-16(20-11-19-15)21-7-1-2-12(9-21)10-22/h3-4,8,11-12,22H,1-2,5-7,9-10H2,(H,18,19,20) |
| InChIKey | RHAAWBUKBQLXKV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |