C21H30N6O — CID 133297322
[1-[6-[(2-piperidin-1-yl-4-pyridinyl)methylamino]pyrimidin-4-yl]piperidin-3-yl]methanol (PubChem CID 133297322) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is [1-[6-[(2-piperidin-1-yl-4-pyridinyl)methylamino]pyrimidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[6-[(2-piperidin-1-yl-4-pyridinyl)methylamino]pyrimidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 133297322 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [1-[6-[(2-piperidin-1-yl-4-pyridinyl)methylamino]pyrimidin-4-yl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(c2cc(NCc3ccnc(N4CCCCC4)c3)ncn2)C1 |
| InChI | InChI=1S/C21H30N6O/c28-15-18-5-4-10-27(14-18)21-12-19(24-16-25-21)23-13-17-6-7-22-20(11-17)26-8-2-1-3-9-26/h6-7,11-12,16,18,28H,1-5,8-10,13-15H2,(H,23,24,25) |
| InChIKey | ZOZQADYJYZLFPN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |