C19H25BrN4O — CID 133293839
[1-[6-[3-(3-bromophenyl)propylamino]pyrimidin-4-yl]piperidin-3-yl]methanol (PubChem CID 133293839) has the molecular formula C19H25BrN4O and a molecular weight of 405.34 g/mol. Its IUPAC name is [1-[6-[3-(3-bromophenyl)propylamino]pyrimidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[6-[3-(3-bromophenyl)propylamino]pyrimidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 133293839 |
| Molecular Formula | C19H25BrN4O |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [1-[6-[3-(3-bromophenyl)propylamino]pyrimidin-4-yl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(c2cc(NCCCc3cccc(Br)c3)ncn2)C1 |
| InChI | InChI=1S/C19H25BrN4O/c20-17-7-1-4-15(10-17)5-2-8-21-18-11-19(23-14-22-18)24-9-3-6-16(12-24)13-25/h1,4,7,10-11,14,16,25H,2-3,5-6,8-9,12-13H2,(H,21,22,23) |
| InChIKey | FGVSWLOMQSVLKB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|