C21H27FN4O — CID 133300453
[1-[6-[[1-(4-fluorophenyl)cyclobutyl]methylamino]pyrimidin-4-yl]piperidin-3-yl]methanol (PubChem CID 133300453) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is [1-[6-[[1-(4-fluorophenyl)cyclobutyl]methylamino]pyrimidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[6-[[1-(4-fluorophenyl)cyclobutyl]methylamino]pyrimidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 133300453 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | [1-[6-[[1-(4-fluorophenyl)cyclobutyl]methylamino]pyrimidin-4-yl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(c2cc(NCC3(c4ccc(F)cc4)CCC3)ncn2)C1 |
| InChI | InChI=1S/C21H27FN4O/c22-18-6-4-17(5-7-18)21(8-2-9-21)14-23-19-11-20(25-15-24-19)26-10-1-3-16(12-26)13-27/h4-7,11,15-16,27H,1-3,8-10,12-14H2,(H,23,24,25) |
| InChIKey | NOYILNVJZHIIFX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |