C15H16FN3 — CID 133297192
N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-6-methylpyrimidin-4-amine (PubChem CID 133297192) has the molecular formula C15H16FN3 and a molecular weight of 257.31 g/mol. Its IUPAC name is N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-6-methylpyrimidin-4-amine.
| Compound Name | N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133297192 |
| Molecular Formula | C15H16FN3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-[[1-(4-fluorophenyl)cyclopropyl]methyl]-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(NCC2(c3ccc(F)cc3)CC2)ncn1 |
| InChI | InChI=1S/C15H16FN3/c1-11-8-14(19-10-18-11)17-9-15(6-7-15)12-2-4-13(16)5-3-12/h2-5,8,10H,6-7,9H2,1H3,(H,17,18,19) |
| InChIKey | HMMPJRIGOUEJCA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |