C28H27NP2 — CID 13329891
[(3S,4S)-4-diphenylphosphanylpyrrolidin-3-yl]-diphenylphosphane (PubChem CID 13329891) has the molecular formula C28H27NP2 and a molecular weight of 439.48 g/mol. Its IUPAC name is [(3S,4S)-4-diphenylphosphanylpyrrolidin-3-yl]-diphenylphosphane.
| Compound Name | [(3S,4S)-4-diphenylphosphanylpyrrolidin-3-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 13329891 |
| Molecular Formula | C28H27NP2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [(3S,4S)-4-diphenylphosphanylpyrrolidin-3-yl]-diphenylphosphane |
| SMILES | c1ccc(P(c2ccccc2)[C@H]2CNC[C@@H]2P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27NP2/c1-5-13-23(14-6-1)30(24-15-7-2-8-16-24)27-21-29-22-28(27)31(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27-29H,21-22H2/t27-,28-/m0/s1 |
| InChIKey | YMRKZKDKJJCIHH-NSOVKSMOSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|