About 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide
3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide (PubChem CID 46905932) has the molecular formula C26H35Br2NP+
and a molecular weight of 552.36 g/mol. Its IUPAC name is 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide.
Molecular Properties
| Compound Name | 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide |
| PubChem CID | 46905932 |
| Molecular Formula | C26H35Br2NP+ |
| Molecular Weight | 552.36 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide |
| SMILES | Br.Br.CCCCCNCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H33NP.2BrH/c1-2-3-13-21-27-22-14-23-28(24-15-7-4-8-16-24,25-17-9-5-10-18-25)26-19-11-6-12-20-26;;/h4-12,15-20,27H,2-3,13-14,21-23H2,1H3;2*1H/q+1;; |
| InChIKey | TZWSVNDFCGDPAR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.36 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide?
The IUPAC name of 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide (CID 46905932) is 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide.
What is the SMILES notation for 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide?
The canonical SMILES for 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide is Br.Br.CCCCCNCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide?
The InChIKey is TZWSVNDFCGDPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H33NP.2BrH/c1-2-3-13-21-27-22-14-23-28(24-15-7-4-8-16-24,25-17-9-5-10-18-25)26-19-11-6-12-20-26;;/h4-12,15-20,27H,2-3,13-14,21-23H2,1H3;2*1H/q+1;;.
What are the key properties of 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide?
3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide has a molecular weight of 552.36 g/mol, XLogP of 6.31, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(pentylamino)propyl-triphenylphosphanium;dihydrobromide is sourced from PubChem (CID 46905932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).