C19H25ClN6O — CID 133299161
[1-[6-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]pyrimidin-4-yl]piperidin-3-yl]methanol (PubChem CID 133299161) has the molecular formula C19H25ClN6O and a molecular weight of 388.90 g/mol. Its IUPAC name is [1-[6-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]pyrimidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[6-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]pyrimidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 133299161 |
| Molecular Formula | C19H25ClN6O |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [1-[6-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]pyrimidin-4-yl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(c2cc(N3CCN(c4ccc(Cl)cn4)CC3)ncn2)C1 |
| InChI | InChI=1S/C19H25ClN6O/c20-16-3-4-17(21-11-16)24-6-8-25(9-7-24)18-10-19(23-14-22-18)26-5-1-2-15(12-26)13-27/h3-4,10-11,14-15,27H,1-2,5-9,12-13H2 |
| InChIKey | YYKSWWRZFXYEBV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |