C19H28N6O — CID 133300724
[1-[6-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]pyrimidin-4-yl]piperidin-3-yl]methanol (PubChem CID 133300724) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is [1-[6-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]pyrimidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[6-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]pyrimidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 133300724 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | [1-[6-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]pyrimidin-4-yl]piperidin-3-yl]methanol |
| SMILES | Cn1nccc1C1CCN(c2cc(N3CCCC(CO)C3)ncn2)CC1 |
| InChI | InChI=1S/C19H28N6O/c1-23-17(4-7-22-23)16-5-9-24(10-6-16)18-11-19(21-14-20-18)25-8-2-3-15(12-25)13-26/h4,7,11,14-16,26H,2-3,5-6,8-10,12-13H2,1H3 |
| InChIKey | MWDQRJGLSRISPG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |