About N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine
N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine (PubChem CID 133301785) has the molecular formula C17H20N8
and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine.
Molecular Properties
| Compound Name | N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine |
| PubChem CID | 133301785 |
| Molecular Formula | C17H20N8 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine |
| SMILES | CNc1cc(N2CCCC2CNc2ccc3nccnc3n2)ncn1 |
| InChI | InChI=1S/C17H20N8/c1-18-15-9-16(23-11-22-15)25-8-2-3-12(25)10-21-14-5-4-13-17(24-14)20-7-6-19-13/h4-7,9,11-12H,2-3,8,10H2,1H3,(H,18,22,23)(H,20,21,24) |
| InChIKey | JOGXRPJPEPFTFG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine?
The IUPAC name of N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine (CID 133301785) is N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine.
What is the SMILES notation for N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine?
The canonical SMILES for N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine is CNc1cc(N2CCCC2CNc2ccc3nccnc3n2)ncn1.
What is the InChIKey of N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine?
The InChIKey is JOGXRPJPEPFTFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N8/c1-18-15-9-16(23-11-22-15)25-8-2-3-12(25)10-21-14-5-4-13-17(24-14)20-7-6-19-13/h4-7,9,11-12H,2-3,8,10H2,1H3,(H,18,22,23)(H,20,21,24).
What are the key properties of N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine?
N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine has a molecular weight of 336.40 g/mol, XLogP of 1.94, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methyl]pyrido[2,3-b]pyrazin-6-amine is sourced from PubChem (CID 133301785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).