C15H18N8 — CID 146075842
3-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methylamino]pyrazine-2-carbonitrile (PubChem CID 146075842) has the molecular formula C15H18N8 and a molecular weight of 310.37 g/mol. Its IUPAC name is 3-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 146075842 |
| Molecular Formula | C15H18N8 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 3-[[1-[6-(methylamino)pyrimidin-4-yl]pyrrolidin-2-yl]methylamino]pyrazine-2-carbonitrile |
| SMILES | CNc1cc(N2CCCC2CNc2nccnc2C#N)ncn1 |
| InChI | InChI=1S/C15H18N8/c1-17-13-7-14(22-10-21-13)23-6-2-3-11(23)9-20-15-12(8-16)18-4-5-19-15/h4-5,7,10-11H,2-3,6,9H2,1H3,(H,19,20)(H,17,21,22) |
| InChIKey | OFDFLHVKIZTEEN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |