C19H22ClN5O — CID 133304134
[1-[6-[2-(6-chloro-1H-indol-3-yl)ethylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 133304134) has the molecular formula C19H22ClN5O and a molecular weight of 371.87 g/mol. Its IUPAC name is [1-[6-[2-(6-chloro-1H-indol-3-yl)ethylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[6-[2-(6-chloro-1H-indol-3-yl)ethylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 133304134 |
| Molecular Formula | C19H22ClN5O |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [1-[6-[2-(6-chloro-1H-indol-3-yl)ethylamino]pyrimidin-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1c1cc(NCCc2c[nH]c3cc(Cl)ccc23)ncn1 |
| InChI | InChI=1S/C19H22ClN5O/c20-14-3-4-16-13(10-22-17(16)8-14)5-6-21-18-9-19(24-12-23-18)25-7-1-2-15(25)11-26/h3-4,8-10,12,15,22,26H,1-2,5-7,11H2,(H,21,23,24) |
| InChIKey | WWUUIEIWTKFPAQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |