C14H14N6O — CID 133304730
6-[[1-(1-methylpyrazol-4-yl)-2-oxopyrrolidin-3-yl]amino]pyridine-2-carbonitrile (PubChem CID 133304730) has the molecular formula C14H14N6O and a molecular weight of 282.31 g/mol. Its IUPAC name is 6-[[1-(1-methylpyrazol-4-yl)-2-oxopyrrolidin-3-yl]amino]pyridine-2-carbonitrile.
| Compound Name | 6-[[1-(1-methylpyrazol-4-yl)-2-oxopyrrolidin-3-yl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133304730 |
| Molecular Formula | C14H14N6O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 6-[[1-(1-methylpyrazol-4-yl)-2-oxopyrrolidin-3-yl]amino]pyridine-2-carbonitrile |
| SMILES | Cn1cc(N2CCC(Nc3cccc(C#N)n3)C2=O)cn1 |
| InChI | InChI=1S/C14H14N6O/c1-19-9-11(8-16-19)20-6-5-12(14(20)21)18-13-4-2-3-10(7-15)17-13/h2-4,8-9,12H,5-6H2,1H3,(H,17,18) |
| InChIKey | VLBREWRBECCOPC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |