C11H12N4O — CID 103680905
6-[(1-methyl-2-oxopyrrolidin-3-yl)amino]pyridine-2-carbonitrile (PubChem CID 103680905) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 6-[(1-methyl-2-oxopyrrolidin-3-yl)amino]pyridine-2-carbonitrile.
| Compound Name | 6-[(1-methyl-2-oxopyrrolidin-3-yl)amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 103680905 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 6-[(1-methyl-2-oxopyrrolidin-3-yl)amino]pyridine-2-carbonitrile |
| SMILES | CN1CCC(Nc2cccc(C#N)n2)C1=O |
| InChI | InChI=1S/C11H12N4O/c1-15-6-5-9(11(15)16)14-10-4-2-3-8(7-12)13-10/h2-4,9H,5-6H2,1H3,(H,13,14) |
| InChIKey | MXMARFRJDCWEMG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |