C13H16N4 — CID 64587165
6-(1-azabicyclo[2.2.2]octan-3-ylamino)pyridine-2-carbonitrile (PubChem CID 64587165) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 6-(1-azabicyclo[2.2.2]octan-3-ylamino)pyridine-2-carbonitrile.
| Compound Name | 6-(1-azabicyclo[2.2.2]octan-3-ylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 64587165 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 6-(1-azabicyclo[2.2.2]octan-3-ylamino)pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(NC2CN3CCC2CC3)n1 |
| InChI | InChI=1S/C13H16N4/c14-8-11-2-1-3-13(15-11)16-12-9-17-6-4-10(12)5-7-17/h1-3,10,12H,4-7,9H2,(H,15,16) |
| InChIKey | SUMYBXLZLWSHGM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |